C19H27NO — CID 62522506
6,6-dimethylspiro[4,4a,5,10b-tetrahydro-2H-benzo[h][1,4]benzoxazine-3,1'-cyclohexane] (PubChem CID 62522506) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is 6,6-dimethylspiro[4,4a,5,10b-tetrahydro-2H-benzo[h][1,4]benzoxazine-3,1'-cyclohexane].
| Compound Name | 6,6-dimethylspiro[4,4a,5,10b-tetrahydro-2H-benzo[h][1,4]benzoxazine-3,1'-cyclohexane] |
|---|---|
| PubChem CID | 62522506 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 6,6-dimethylspiro[4,4a,5,10b-tetrahydro-2H-benzo[h][1,4]benzoxazine-3,1'-cyclohexane] |
| SMILES | CC1(C)CC2NC3(CCCCC3)COC2c2ccccc21 |
| InChI | InChI=1S/C19H27NO/c1-18(2)12-16-17(14-8-4-5-9-15(14)18)21-13-19(20-16)10-6-3-7-11-19/h4-5,8-9,16-17,20H,3,6-7,10-13H2,1-2H3 |
| InChIKey | JFLRHBJLMJMRTL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |