C14H25NO — CID 115824706
7,7-dimethylspiro[2,4,4a,5,6,7a-hexahydrocyclopenta[b][1,4]oxazine-3,1'-cyclohexane] (PubChem CID 115824706) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 7,7-dimethylspiro[2,4,4a,5,6,7a-hexahydrocyclopenta[b][1,4]oxazine-3,1'-cyclohexane].
| Compound Name | 7,7-dimethylspiro[2,4,4a,5,6,7a-hexahydrocyclopenta[b][1,4]oxazine-3,1'-cyclohexane] |
|---|---|
| PubChem CID | 115824706 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 7,7-dimethylspiro[2,4,4a,5,6,7a-hexahydrocyclopenta[b][1,4]oxazine-3,1'-cyclohexane] |
| SMILES | CC1(C)CCC2NC3(CCCCC3)COC21 |
| InChI | InChI=1S/C14H25NO/c1-13(2)9-6-11-12(13)16-10-14(15-11)7-4-3-5-8-14/h11-12,15H,3-10H2,1-2H3 |
| InChIKey | PRYWSLAQJVOKSS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |