C17H31NO — CID 62521796
6-tert-butylspiro[2,4,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-3,1'-cyclohexane] (PubChem CID 62521796) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is 6-tert-butylspiro[2,4,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-3,1'-cyclohexane].
| Compound Name | 6-tert-butylspiro[2,4,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-3,1'-cyclohexane] |
|---|---|
| PubChem CID | 62521796 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | 6-tert-butylspiro[2,4,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-3,1'-cyclohexane] |
| SMILES | CC(C)(C)C1CCC2OCC3(CCCCC3)NC2C1 |
| InChI | InChI=1S/C17H31NO/c1-16(2,3)13-7-8-15-14(11-13)18-17(12-19-15)9-5-4-6-10-17/h13-15,18H,4-12H2,1-3H3 |
| InChIKey | DBFOGLIELFIXJU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |