C30H56O6 — CID 89050077
11,25-ditert-butyl-25-methyl-2,5,8,15,18,21-hexaoxatricyclo[20.5.0.09,14]heptacosane (PubChem CID 89050077) has the molecular formula C30H56O6 and a molecular weight of 512.77 g/mol. Its IUPAC name is 11,25-ditert-butyl-25-methyl-2,5,8,15,18,21-hexaoxatricyclo[20.5.0.09,14]heptacosane.
| Compound Name | 11,25-ditert-butyl-25-methyl-2,5,8,15,18,21-hexaoxatricyclo[20.5.0.09,14]heptacosane |
|---|---|
| PubChem CID | 89050077 |
| Molecular Formula | C30H56O6 |
| Molecular Weight | 512.77 g/mol |
| Exact Mass | 512.41 |
| IUPAC Name | 11,25-ditert-butyl-25-methyl-2,5,8,15,18,21-hexaoxatricyclo[20.5.0.09,14]heptacosane |
| SMILES | CC(C)(C)C1CCC2OCCOCCOC3CCC(C)(C(C)(C)C)CCC3OCCOCCOC2C1 |
| InChI | InChI=1S/C30H56O6/c1-28(2,3)23-8-9-24-27(22-23)36-21-17-32-16-20-35-26-11-13-30(7,29(4,5)6)12-10-25(26)34-19-15-31-14-18-33-24/h23-27H,8-22H2,1-7H3 |
| InChIKey | XORVLWQQTBLIMG-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.77 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |