C11H20O — CID 58853131
(3aS,5S,6aS)-5-tert-butyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan (PubChem CID 58853131) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (3aS,5S,6aS)-5-tert-butyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan.
| Compound Name | (3aS,5S,6aS)-5-tert-butyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan |
|---|---|
| PubChem CID | 58853131 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (3aS,5S,6aS)-5-tert-butyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan |
| SMILES | CC(C)(C)[C@H]1C[C@H]2CCO[C@H]2C1 |
| InChI | InChI=1S/C11H20O/c1-11(2,3)9-6-8-4-5-12-10(8)7-9/h8-10H,4-7H2,1-3H3/t8-,9+,10+/m1/s1 |
| InChIKey | ACPCOUDFROHMOY-UTLUCORTSA-N |
| XLogP | 2.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |