C13H23NO — CID 115824704
7,7-dimethylspiro[2,4,4a,5,6,7a-hexahydrocyclopenta[b][1,4]oxazine-3,1'-cyclopentane] (PubChem CID 115824704) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 7,7-dimethylspiro[2,4,4a,5,6,7a-hexahydrocyclopenta[b][1,4]oxazine-3,1'-cyclopentane].
| Compound Name | 7,7-dimethylspiro[2,4,4a,5,6,7a-hexahydrocyclopenta[b][1,4]oxazine-3,1'-cyclopentane] |
|---|---|
| PubChem CID | 115824704 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 7,7-dimethylspiro[2,4,4a,5,6,7a-hexahydrocyclopenta[b][1,4]oxazine-3,1'-cyclopentane] |
| SMILES | CC1(C)CCC2NC3(CCCC3)COC21 |
| InChI | InChI=1S/C13H23NO/c1-12(2)8-5-10-11(12)15-9-13(14-10)6-3-4-7-13/h10-11,14H,3-9H2,1-2H3 |
| InChIKey | ICCXRZBSOBZLQE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |