C12H22N2 — CID 66800407
spiro[2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxaline-3,1'-cyclopentane] (PubChem CID 66800407) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is spiro[2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxaline-3,1'-cyclopentane].
| Compound Name | spiro[2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxaline-3,1'-cyclopentane] |
|---|---|
| PubChem CID | 66800407 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | spiro[2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxaline-3,1'-cyclopentane] |
| SMILES | C1CCC2NC3(CCCC3)CNC2C1 |
| InChI | InChI=1S/C12H22N2/c1-2-6-11-10(5-1)13-9-12(14-11)7-3-4-8-12/h10-11,13-14H,1-9H2 |
| InChIKey | CUAQALDMAHLMSK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |