C16H30N4 — CID 15423024
(4aR,6aS,10aS,12aR)-5a,11a-dimethyl-1,2,3,4,4a,5,6,6a,7,8,9,10,10a,11,12,12a-hexadecahydroquinoxalino[2,3-b]quinoxaline (PubChem CID 15423024) has the molecular formula C16H30N4 and a molecular weight of 278.44 g/mol. Its IUPAC name is (4aR,6aS,10aS,12aR)-5a,11a-dimethyl-1,2,3,4,4a,5,6,6a,7,8,9,10,10a,11,12,12a-hexadecahydroquinoxalino[2,3-b]quinoxaline.
| Compound Name | (4aR,6aS,10aS,12aR)-5a,11a-dimethyl-1,2,3,4,4a,5,6,6a,7,8,9,10,10a,11,12,12a-hexadecahydroquinoxalino[2,3-b]quinoxaline |
|---|---|
| PubChem CID | 15423024 |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | (4aR,6aS,10aS,12aR)-5a,11a-dimethyl-1,2,3,4,4a,5,6,6a,7,8,9,10,10a,11,12,12a-hexadecahydroquinoxalino[2,3-b]quinoxaline |
| SMILES | CC12N[C@H]3CCCC[C@@H]3NC1(C)N[C@@H]1CCCC[C@H]1N2 |
| InChI | InChI=1S/C16H30N4/c1-15-16(2,19-13-9-5-3-7-11(13)17-15)20-14-10-6-4-8-12(14)18-15/h11-14,17-20H,3-10H2,1-2H3/t11-,12+,13-,14+,15?,16? |
| InChIKey | GQJJAIQIZHKNMV-WYUYUUCSSA-N |
| XLogP | 1.43 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |