C14H18 — CID 144661541
3,3-dimethyl-1-[(Z)-prop-1-enyl]-1,2-dihydroindene (PubChem CID 144661541) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(Z)-prop-1-enyl]-1,2-dihydroindene.
| Compound Name | 3,3-dimethyl-1-[(Z)-prop-1-enyl]-1,2-dihydroindene |
|---|---|
| PubChem CID | 144661541 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 3,3-dimethyl-1-[(Z)-prop-1-enyl]-1,2-dihydroindene |
| SMILES | C/C=C\C1CC(C)(C)c2ccccc21 |
| InChI | InChI=1S/C14H18/c1-4-7-11-10-14(2,3)13-9-6-5-8-12(11)13/h4-9,11H,10H2,1-3H3/b7-4- |
| InChIKey | FXKQHNTUEUFQEF-DAXSKMNVSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|