About (2R)-2-[2-(1,3-dioxolan-2-yl)ethyl]piperidine
(2R)-2-[2-(1,3-dioxolan-2-yl)ethyl]piperidine (PubChem CID 10559432) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is (2R)-2-[2-(1,3-dioxolan-2-yl)ethyl]piperidine.
Molecular Properties
| Compound Name | (2R)-2-[2-(1,3-dioxolan-2-yl)ethyl]piperidine |
| PubChem CID | 10559432 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (2R)-2-[2-(1,3-dioxolan-2-yl)ethyl]piperidine |
| SMILES | C1CC[C@H](CCC2OCCO2)NC1 |
| InChI | InChI=1S/C10H19NO2/c1-2-6-11-9(3-1)4-5-10-12-7-8-13-10/h9-11H,1-8H2/t9-/m1/s1 |
| InChIKey | WTPIBEYBQYBAOM-SECBINFHSA-N |
| XLogP | 1.28 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-[2-(1,3-dioxolan-2-yl)ethyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[2-(1,3-dioxolan-2-yl)ethyl]piperidine?
The IUPAC name of (2R)-2-[2-(1,3-dioxolan-2-yl)ethyl]piperidine (CID 10559432) is (2R)-2-[2-(1,3-dioxolan-2-yl)ethyl]piperidine.
What is the SMILES notation for (2R)-2-[2-(1,3-dioxolan-2-yl)ethyl]piperidine?
The canonical SMILES for (2R)-2-[2-(1,3-dioxolan-2-yl)ethyl]piperidine is C1CC[C@H](CCC2OCCO2)NC1.
What is the InChIKey of (2R)-2-[2-(1,3-dioxolan-2-yl)ethyl]piperidine?
The InChIKey is WTPIBEYBQYBAOM-SECBINFHSA-N. The full InChI is InChI=1S/C10H19NO2/c1-2-6-11-9(3-1)4-5-10-12-7-8-13-10/h9-11H,1-8H2/t9-/m1/s1.
What are the key properties of (2R)-2-[2-(1,3-dioxolan-2-yl)ethyl]piperidine?
(2R)-2-[2-(1,3-dioxolan-2-yl)ethyl]piperidine has a molecular weight of 185.27 g/mol, XLogP of 1.28, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[2-(1,3-dioxolan-2-yl)ethyl]piperidine is sourced from PubChem (CID 10559432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).