C12H12Cl2O3 — CID 103543640
1-(2,4-dichlorophenyl)-3-(1,3-dioxolan-2-yl)propan-2-one (PubChem CID 103543640) has the molecular formula C12H12Cl2O3 and a molecular weight of 275.13 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-(1,3-dioxolan-2-yl)propan-2-one.
| Compound Name | 1-(2,4-dichlorophenyl)-3-(1,3-dioxolan-2-yl)propan-2-one |
|---|---|
| PubChem CID | 103543640 |
| Molecular Formula | C12H12Cl2O3 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-(1,3-dioxolan-2-yl)propan-2-one |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)CC1OCCO1 |
| InChI | InChI=1S/C12H12Cl2O3/c13-9-2-1-8(11(14)6-9)5-10(15)7-12-16-3-4-17-12/h1-2,6,12H,3-5,7H2 |
| InChIKey | KMAQETSRONZYCK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |