C14H15BrO3 — CID 53411629
2-[2-(4-bromophenyl)-2-oxoethyl]cyclopentane-1-carboxylic acid (PubChem CID 53411629) has the molecular formula C14H15BrO3 and a molecular weight of 311.17 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)-2-oxoethyl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[2-(4-bromophenyl)-2-oxoethyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 53411629 |
| Molecular Formula | C14H15BrO3 |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 2-[2-(4-bromophenyl)-2-oxoethyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(CC1CCCC1C(=O)O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H15BrO3/c15-11-6-4-9(5-7-11)13(16)8-10-2-1-3-12(10)14(17)18/h4-7,10,12H,1-3,8H2,(H,17,18) |
| InChIKey | MPWKHQPBFZKBHK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |