C14H17NO4 — CID 101175752
(Z)-3-amino-4-(1,3-dioxolan-2-yl)-1-(4-methoxyphenyl)but-2-en-1-one (PubChem CID 101175752) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is (Z)-3-amino-4-(1,3-dioxolan-2-yl)-1-(4-methoxyphenyl)but-2-en-1-one.
| Compound Name | (Z)-3-amino-4-(1,3-dioxolan-2-yl)-1-(4-methoxyphenyl)but-2-en-1-one |
|---|---|
| PubChem CID | 101175752 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (Z)-3-amino-4-(1,3-dioxolan-2-yl)-1-(4-methoxyphenyl)but-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C(\N)CC2OCCO2)cc1 |
| InChI | InChI=1S/C14H17NO4/c1-17-12-4-2-10(3-5-12)13(16)8-11(15)9-14-18-6-7-19-14/h2-5,8,14H,6-7,9,15H2,1H3/b11-8- |
| InChIKey | GTCXFKHQXYXIFX-FLIBITNWSA-N |
| XLogP | 1.48 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|