C17H17AlO4 — CID 157274158
(Z)-3-alumanyloxy-1,3-bis(4-methoxyphenyl)prop-2-en-1-one (PubChem CID 157274158) has the molecular formula C17H17AlO4 and a molecular weight of 312.30 g/mol. Its IUPAC name is (Z)-3-alumanyloxy-1,3-bis(4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (Z)-3-alumanyloxy-1,3-bis(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 157274158 |
| Molecular Formula | C17H17AlO4 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | (Z)-3-alumanyloxy-1,3-bis(4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C(\O[AlH2])c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C17H16O4.Al.2H/c1-20-14-7-3-12(4-8-14)16(18)11-17(19)13-5-9-15(21-2)10-6-13;;;/h3-11,18H,1-2H3;;;/q;+1;;/p-1/b16-11-;;; |
| InChIKey | AYWVDKYONLNQTB-BATHGBDNSA-M |
| XLogP | 2.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|