C16H20O4 — CID 162284243
(3R,4S,5R)-2-(2-methylidene-4-phenylbut-3-enyl)oxane-3,4,5-triol (PubChem CID 162284243) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (3R,4S,5R)-2-(2-methylidene-4-phenylbut-3-enyl)oxane-3,4,5-triol.
| Compound Name | (3R,4S,5R)-2-(2-methylidene-4-phenylbut-3-enyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162284243 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (3R,4S,5R)-2-(2-methylidene-4-phenylbut-3-enyl)oxane-3,4,5-triol |
| SMILES | C=C(C=Cc1ccccc1)CC1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H20O4/c1-11(7-8-12-5-3-2-4-6-12)9-14-16(19)15(18)13(17)10-20-14/h2-8,13-19H,1,9-10H2/t13-,14?,15+,16+/m1/s1 |
| InChIKey | GWZBBEMKDGZBRP-PLZVMKCUSA-N |
| XLogP | 1.13 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|