C12H11F3 — CID 102489190
[(E)-5,5,5-trifluoro-3-methylidenepent-1-enyl]benzene (PubChem CID 102489190) has the molecular formula C12H11F3 and a molecular weight of 212.21 g/mol. Its IUPAC name is [(E)-5,5,5-trifluoro-3-methylidenepent-1-enyl]benzene.
| Compound Name | [(E)-5,5,5-trifluoro-3-methylidenepent-1-enyl]benzene |
|---|---|
| PubChem CID | 102489190 |
| Molecular Formula | C12H11F3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | [(E)-5,5,5-trifluoro-3-methylidenepent-1-enyl]benzene |
| SMILES | C=C(/C=C/c1ccccc1)CC(F)(F)F |
| InChI | InChI=1S/C12H11F3/c1-10(9-12(13,14)15)7-8-11-5-3-2-4-6-11/h2-8H,1,9H2/b8-7+ |
| InChIKey | RWKRAJGTBIONDX-BQYQJAHWSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|