C16H13F3 — CID 122231581
1-[(E)-2-phenylethenyl]-4-(2,2,2-trifluoroethyl)benzene (PubChem CID 122231581) has the molecular formula C16H13F3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 1-[(E)-2-phenylethenyl]-4-(2,2,2-trifluoroethyl)benzene.
| Compound Name | 1-[(E)-2-phenylethenyl]-4-(2,2,2-trifluoroethyl)benzene |
|---|---|
| PubChem CID | 122231581 |
| Molecular Formula | C16H13F3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 1-[(E)-2-phenylethenyl]-4-(2,2,2-trifluoroethyl)benzene |
| SMILES | FC(F)(F)Cc1ccc(/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C16H13F3/c17-16(18,19)12-15-10-8-14(9-11-15)7-6-13-4-2-1-3-5-13/h1-11H,12H2/b7-6+ |
| InChIKey | KIQGSLOVFZODBM-VOTSOKGWSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|