C18H16F2 — CID 122230138
[(1E,3E)-5,5-difluoro-6-phenylhexa-1,3-dienyl]benzene (PubChem CID 122230138) has the molecular formula C18H16F2 and a molecular weight of 270.32 g/mol. Its IUPAC name is [(1E,3E)-5,5-difluoro-6-phenylhexa-1,3-dienyl]benzene.
| Compound Name | [(1E,3E)-5,5-difluoro-6-phenylhexa-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 122230138 |
| Molecular Formula | C18H16F2 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | [(1E,3E)-5,5-difluoro-6-phenylhexa-1,3-dienyl]benzene |
| SMILES | FC(F)(/C=C/C=C/c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C18H16F2/c19-18(20,15-17-12-5-2-6-13-17)14-8-7-11-16-9-3-1-4-10-16/h1-14H,15H2/b11-7+,14-8+ |
| InChIKey | SKJJOGPRIJWBEU-HPIZBCMHSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|