C15H21N — CID 10608725
(4E,6E)-3-ethyl-7-phenylhepta-4,6-dien-3-amine (PubChem CID 10608725) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (4E,6E)-3-ethyl-7-phenylhepta-4,6-dien-3-amine.
| Compound Name | (4E,6E)-3-ethyl-7-phenylhepta-4,6-dien-3-amine |
|---|---|
| PubChem CID | 10608725 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (4E,6E)-3-ethyl-7-phenylhepta-4,6-dien-3-amine |
| SMILES | CCC(N)(/C=C/C=C/c1ccccc1)CC |
| InChI | InChI=1S/C15H21N/c1-3-15(16,4-2)13-9-8-12-14-10-6-5-7-11-14/h5-13H,3-4,16H2,1-2H3/b12-8+,13-9+ |
| InChIKey | JZYGNVQCGOEGGO-QHKWOANTSA-N |
| XLogP | 3.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|