About 4-phenylbuta-1,3-dienylbenzene;bis(tripropylphosphane)
4-phenylbuta-1,3-dienylbenzene;bis(tripropylphosphane) (PubChem CID 173264936) has the molecular formula C34H56P2
and a molecular weight of 526.77 g/mol. Its IUPAC name is 4-phenylbuta-1,3-dienylbenzene;bis(tripropylphosphane).
Molecular Properties
| Compound Name | 4-phenylbuta-1,3-dienylbenzene;bis(tripropylphosphane) |
| PubChem CID | 173264936 |
| Molecular Formula | C34H56P2 |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 526.39 |
| IUPAC Name | 4-phenylbuta-1,3-dienylbenzene;bis(tripropylphosphane) |
| SMILES | C(C=Cc1ccccc1)=Cc1ccccc1.CCCP(CCC)CCC.CCCP(CCC)CCC |
| InChI | InChI=1S/C16H14.2C9H21P/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16;2*1-4-7-10(8-5-2)9-6-3/h1-14H;2*4-9H2,1-3H3 |
| InChIKey | UBBYGNPWTWNPJU-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylbuta-1,3-dienylbenzene;bis(tripropylphosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylbuta-1,3-dienylbenzene;bis(tripropylphosphane)?
The IUPAC name of 4-phenylbuta-1,3-dienylbenzene;bis(tripropylphosphane) (CID 173264936) is 4-phenylbuta-1,3-dienylbenzene;bis(tripropylphosphane).
What is the SMILES notation for 4-phenylbuta-1,3-dienylbenzene;bis(tripropylphosphane)?
The canonical SMILES for 4-phenylbuta-1,3-dienylbenzene;bis(tripropylphosphane) is C(C=Cc1ccccc1)=Cc1ccccc1.CCCP(CCC)CCC.CCCP(CCC)CCC.
What is the InChIKey of 4-phenylbuta-1,3-dienylbenzene;bis(tripropylphosphane)?
The InChIKey is UBBYGNPWTWNPJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14.2C9H21P/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16;2*1-4-7-10(8-5-2)9-6-3/h1-14H;2*4-9H2,1-3H3.
What are the key properties of 4-phenylbuta-1,3-dienylbenzene;bis(tripropylphosphane)?
4-phenylbuta-1,3-dienylbenzene;bis(tripropylphosphane) has a molecular weight of 526.77 g/mol, XLogP of 11.81, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylbuta-1,3-dienylbenzene;bis(tripropylphosphane) is sourced from PubChem (CID 173264936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).