C20H13F15N2 — CID 101182016
3-amino-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-3-[(1E,3E)-4-phenylbuta-1,3-dienyl]decanenitrile (PubChem CID 101182016) has the molecular formula C20H13F15N2 and a molecular weight of 566.31 g/mol. Its IUPAC name is 3-amino-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-3-[(1E,3E)-4-phenylbuta-1,3-dienyl]decanenitrile.
| Compound Name | 3-amino-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-3-[(1E,3E)-4-phenylbuta-1,3-dienyl]decanenitrile |
|---|---|
| PubChem CID | 101182016 |
| Molecular Formula | C20H13F15N2 |
| Molecular Weight | 566.31 g/mol |
| Exact Mass | 566.08 |
| IUPAC Name | 3-amino-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-3-[(1E,3E)-4-phenylbuta-1,3-dienyl]decanenitrile |
| SMILES | N#CCC(N)(/C=C/C=C/c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H13F15N2/c21-14(22,13(37,10-11-36)9-5-4-8-12-6-2-1-3-7-12)15(23,24)16(25,26)17(27,28)18(29,30)19(31,32)20(33,34)35/h1-9H,10,37H2/b8-4+,9-5+ |
| InChIKey | FVDVRCSRCOOWJO-KBXRYBNXSA-N |
| XLogP | 7.24 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.31 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|