C19H10F16O2 — CID 173142285
2-cinnamylidene-3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluorodecanoic acid (PubChem CID 173142285) has the molecular formula C19H10F16O2 and a molecular weight of 574.26 g/mol. Its IUPAC name is 2-cinnamylidene-3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluorodecanoic acid.
| Compound Name | 2-cinnamylidene-3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluorodecanoic acid |
|---|---|
| PubChem CID | 173142285 |
| Molecular Formula | C19H10F16O2 |
| Molecular Weight | 574.26 g/mol |
| Exact Mass | 574.04 |
| IUPAC Name | 2-cinnamylidene-3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluorodecanoic acid |
| SMILES | O=C(O)C(=CC=Cc1ccccc1)C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H10F16O2/c20-11(10(12(36)37)8-4-7-9-5-2-1-3-6-9)13(21,22)14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)19(33,34)35/h1-8,11H,(H,36,37) |
| InChIKey | YPGKWYVWEIXPLX-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.26 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|