C19H18F3NO2 — CID 173031411
2-[(2Z,4E)-5-phenylpenta-2,4-dien-2-yl]aniline;2,2,2-trifluoroacetic acid (PubChem CID 173031411) has the molecular formula C19H18F3NO2 and a molecular weight of 349.35 g/mol. Its IUPAC name is 2-[(2Z,4E)-5-phenylpenta-2,4-dien-2-yl]aniline;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(2Z,4E)-5-phenylpenta-2,4-dien-2-yl]aniline;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 173031411 |
| Molecular Formula | C19H18F3NO2 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-[(2Z,4E)-5-phenylpenta-2,4-dien-2-yl]aniline;2,2,2-trifluoroacetic acid |
| SMILES | C/C(=C/C=C/c1ccccc1)c1ccccc1N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H17N.C2HF3O2/c1-14(16-12-5-6-13-17(16)18)8-7-11-15-9-3-2-4-10-15;3-2(4,5)1(6)7/h2-13H,18H2,1H3;(H,6,7)/b11-7+,14-8-; |
| InChIKey | MEQGOZICSVBQFJ-VMFBSLNFSA-N |
| XLogP | 5.02 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|