C13H13F3S — CID 15254375
[(1E,3Z)-4-ethylsulfanyl-5,5,5-trifluoropenta-1,3-dienyl]benzene (PubChem CID 15254375) has the molecular formula C13H13F3S and a molecular weight of 258.31 g/mol. Its IUPAC name is [(1E,3Z)-4-ethylsulfanyl-5,5,5-trifluoropenta-1,3-dienyl]benzene.
| Compound Name | [(1E,3Z)-4-ethylsulfanyl-5,5,5-trifluoropenta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 15254375 |
| Molecular Formula | C13H13F3S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | [(1E,3Z)-4-ethylsulfanyl-5,5,5-trifluoropenta-1,3-dienyl]benzene |
| SMILES | CCS/C(=C\C=C\c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H13F3S/c1-2-17-12(13(14,15)16)10-6-9-11-7-4-3-5-8-11/h3-10H,2H2,1H3/b9-6+,12-10- |
| InChIKey | VNYBODQVDWWRIX-QJUYYABZSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|