C12H11F3O — CID 10868043
(2E,4E)-5-phenyl-3-(trifluoromethyl)penta-2,4-dien-1-ol (PubChem CID 10868043) has the molecular formula C12H11F3O and a molecular weight of 228.21 g/mol. Its IUPAC name is (2E,4E)-5-phenyl-3-(trifluoromethyl)penta-2,4-dien-1-ol.
| Compound Name | (2E,4E)-5-phenyl-3-(trifluoromethyl)penta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 10868043 |
| Molecular Formula | C12H11F3O |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | (2E,4E)-5-phenyl-3-(trifluoromethyl)penta-2,4-dien-1-ol |
| SMILES | OC/C=C(\C=C\c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H11F3O/c13-12(14,15)11(8-9-16)7-6-10-4-2-1-3-5-10/h1-8,16H,9H2/b7-6+,11-8+ |
| InChIKey | CFNDFQDFLAEHPB-HRCSPUOPSA-N |
| XLogP | 3.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|