C15H17NO3 — CID 154477095
N,N-bis(oxiran-2-ylmethyl)-3-phenylprop-2-enamide (PubChem CID 154477095) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is N,N-bis(oxiran-2-ylmethyl)-3-phenylprop-2-enamide.
| Compound Name | N,N-bis(oxiran-2-ylmethyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 154477095 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N,N-bis(oxiran-2-ylmethyl)-3-phenylprop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)N(CC1CO1)CC1CO1 |
| InChI | InChI=1S/C15H17NO3/c17-15(7-6-12-4-2-1-3-5-12)16(8-13-10-18-13)9-14-11-19-14/h1-7,13-14H,8-11H2 |
| InChIKey | OKTKSOSRADURQN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 45.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|