C9H9NO3 — CID 141104282
N,N-dihydroxy-3-phenylprop-2-enamide (PubChem CID 141104282) has the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. Its IUPAC name is N,N-dihydroxy-3-phenylprop-2-enamide.
| Compound Name | N,N-dihydroxy-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 141104282 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | N,N-dihydroxy-3-phenylprop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)N(O)O |
| InChI | InChI=1S/C9H9NO3/c11-9(10(12)13)7-6-8-4-2-1-3-5-8/h1-7,12-13H |
| InChIKey | HWAJOJFJJBWSIW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|