C12H21N3O2 — CID 110142422
(4S,4aS,8aS)-4-piperidin-4-yl-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidin-2-one (PubChem CID 110142422) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is (4S,4aS,8aS)-4-piperidin-4-yl-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidin-2-one.
| Compound Name | (4S,4aS,8aS)-4-piperidin-4-yl-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 110142422 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | (4S,4aS,8aS)-4-piperidin-4-yl-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidin-2-one |
| SMILES | O=C1N[C@H]2OCCC[C@H]2[C@H](C2CCNCC2)N1 |
| InChI | InChI=1S/C12H21N3O2/c16-12-14-10(8-3-5-13-6-4-8)9-2-1-7-17-11(9)15-12/h8-11,13H,1-7H2,(H2,14,15,16)/t9-,10-,11-/m0/s1 |
| InChIKey | ANGGGNJSOSKLFT-DCAQKATOSA-N |
| XLogP | 0.42 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |