C18H18O — CID 134846189
trans-(2S,5R)-2,5-diphenylcyclohexan-1-one (PubChem CID 134846189) has the molecular formula C18H18O and a molecular weight of 250.34 g/mol. Its IUPAC name is trans-(2S,5R)-2,5-diphenylcyclohexan-1-one.
| Compound Name | trans-(2S,5R)-2,5-diphenylcyclohexan-1-one |
|---|---|
| PubChem CID | 134846189 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | trans-(2S,5R)-2,5-diphenylcyclohexan-1-one |
| SMILES | O=C1C[C@H](c2ccccc2)CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H18O/c19-18-13-16(14-7-3-1-4-8-14)11-12-17(18)15-9-5-2-6-10-15/h1-10,16-17H,11-13H2/t16-,17+/m1/s1 |
| InChIKey | RZUQKDSKSNBEKS-SJORKVTESA-N |
| XLogP | 4.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |