C13H16O — CID 134902370
trans-(2R,4S)-4-ethyl-2-phenylcyclopentan-1-one (PubChem CID 134902370) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is trans-(2R,4S)-4-ethyl-2-phenylcyclopentan-1-one.
| Compound Name | trans-(2R,4S)-4-ethyl-2-phenylcyclopentan-1-one |
|---|---|
| PubChem CID | 134902370 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | trans-(2R,4S)-4-ethyl-2-phenylcyclopentan-1-one |
| SMILES | CC[C@@H]1CC(=O)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C13H16O/c1-2-10-8-12(13(14)9-10)11-6-4-3-5-7-11/h3-7,10,12H,2,8-9H2,1H3/t10-,12+/m0/s1 |
| InChIKey | ITXWJESAGRCMHM-CMPLNLGQSA-N |
| XLogP | 3.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |