C23H30O — CID 91576649
ethane;(2R,4S,7R)-7-methyl-2,4-diphenylcyclooctan-1-one (PubChem CID 91576649) has the molecular formula C23H30O and a molecular weight of 322.49 g/mol. Its IUPAC name is ethane;(2R,4S,7R)-7-methyl-2,4-diphenylcyclooctan-1-one.
| Compound Name | ethane;(2R,4S,7R)-7-methyl-2,4-diphenylcyclooctan-1-one |
|---|---|
| PubChem CID | 91576649 |
| Molecular Formula | C23H30O |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | ethane;(2R,4S,7R)-7-methyl-2,4-diphenylcyclooctan-1-one |
| SMILES | CC.C[C@@H]1CC[C@H](c2ccccc2)C[C@H](c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C21H24O.C2H6/c1-16-12-13-19(17-8-4-2-5-9-17)15-20(21(22)14-16)18-10-6-3-7-11-18;1-2/h2-11,16,19-20H,12-15H2,1H3;1-2H3/t16-,19+,20-;/m1./s1 |
| InChIKey | ZMBAQOQUKJPASX-BDXTYCTISA-N |
| XLogP | 6.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |