C14H15NOS — CID 10966784
3-pyridin-2-ylsulfanyl-2,3,4,5,6,7-hexahydroinden-1-one (PubChem CID 10966784) has the molecular formula C14H15NOS and a molecular weight of 245.35 g/mol. Its IUPAC name is 3-pyridin-2-ylsulfanyl-2,3,4,5,6,7-hexahydroinden-1-one.
| Compound Name | 3-pyridin-2-ylsulfanyl-2,3,4,5,6,7-hexahydroinden-1-one |
|---|---|
| PubChem CID | 10966784 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 3-pyridin-2-ylsulfanyl-2,3,4,5,6,7-hexahydroinden-1-one |
| SMILES | O=C1CC(Sc2ccccn2)C2=C1CCCC2 |
| InChI | InChI=1S/C14H15NOS/c16-12-9-13(11-6-2-1-5-10(11)12)17-14-7-3-4-8-15-14/h3-4,7-8,13H,1-2,5-6,9H2 |
| InChIKey | HMLVGLPWGGLTRY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |