C17H22N2OS — CID 40528032
(NZ)-N-[(4E,8E,12S)-12-pyridin-2-ylsulfanylcyclododeca-4,8-dien-1-ylidene]hydroxylamine (PubChem CID 40528032) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is (NZ)-N-[(4E,8E,12S)-12-pyridin-2-ylsulfanylcyclododeca-4,8-dien-1-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(4E,8E,12S)-12-pyridin-2-ylsulfanylcyclododeca-4,8-dien-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 40528032 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (NZ)-N-[(4E,8E,12S)-12-pyridin-2-ylsulfanylcyclododeca-4,8-dien-1-ylidene]hydroxylamine |
| SMILES | O/N=C1/CC/C=C/CC/C=C/CC[C@@H]1Sc1ccccn1 |
| InChI | InChI=1S/C17H22N2OS/c20-19-15-11-7-5-3-1-2-4-6-8-12-16(15)21-17-13-9-10-14-18-17/h3-6,9-10,13-14,16,20H,1-2,7-8,11-12H2/b5-3+,6-4+,19-15-/t16-/m0/s1 |
| InChIKey | ODPYZSKKUGVOPB-WRPCCQJOSA-N |
| XLogP | 4.84 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|