C17H22N2O — CID 43835230
(NE)-N-[(4Z)-8-(3,4-dihydro-2H-quinolin-1-yl)cyclooct-4-en-1-ylidene]hydroxylamine (PubChem CID 43835230) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is (NE)-N-[(4Z)-8-(3,4-dihydro-2H-quinolin-1-yl)cyclooct-4-en-1-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(4Z)-8-(3,4-dihydro-2H-quinolin-1-yl)cyclooct-4-en-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 43835230 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (NE)-N-[(4Z)-8-(3,4-dihydro-2H-quinolin-1-yl)cyclooct-4-en-1-ylidene]hydroxylamine |
| SMILES | O/N=C1\CC/C=C\CCC1N1CCCc2ccccc21 |
| InChI | InChI=1S/C17H22N2O/c20-18-15-10-3-1-2-4-12-17(15)19-13-7-9-14-8-5-6-11-16(14)19/h1-2,5-6,8,11,17,20H,3-4,7,9-10,12-13H2/b2-1-,18-15+ |
| InChIKey | STDGYDUACZLNIR-YPPRMKBDSA-N |
| XLogP | 3.77 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|