C23H22N2O2S — CID 71600742
(4S,5R)-1-benzyl-4-phenylmethoxy-5-pyridin-2-ylsulfanylpyrrolidin-2-one (PubChem CID 71600742) has the molecular formula C23H22N2O2S and a molecular weight of 390.51 g/mol. Its IUPAC name is (4S,5R)-1-benzyl-4-phenylmethoxy-5-pyridin-2-ylsulfanylpyrrolidin-2-one.
| Compound Name | (4S,5R)-1-benzyl-4-phenylmethoxy-5-pyridin-2-ylsulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 71600742 |
| Molecular Formula | C23H22N2O2S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | (4S,5R)-1-benzyl-4-phenylmethoxy-5-pyridin-2-ylsulfanylpyrrolidin-2-one |
| SMILES | O=C1C[C@H](OCc2ccccc2)[C@@H](Sc2ccccn2)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H22N2O2S/c26-22-15-20(27-17-19-11-5-2-6-12-19)23(28-21-13-7-8-14-24-21)25(22)16-18-9-3-1-4-10-18/h1-14,20,23H,15-17H2/t20-,23+/m0/s1 |
| InChIKey | LTSXNACGYWAVFG-NZQKXSOJSA-N |
| XLogP | 4.52 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |