C23H29NO3 — CID 23660469
(4S,5S)-1-benzyl-5-[(1R)-1-hydroxypentyl]-4-phenylmethoxypyrrolidin-2-one (PubChem CID 23660469) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is (4S,5S)-1-benzyl-5-[(1R)-1-hydroxypentyl]-4-phenylmethoxypyrrolidin-2-one.
| Compound Name | (4S,5S)-1-benzyl-5-[(1R)-1-hydroxypentyl]-4-phenylmethoxypyrrolidin-2-one |
|---|---|
| PubChem CID | 23660469 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (4S,5S)-1-benzyl-5-[(1R)-1-hydroxypentyl]-4-phenylmethoxypyrrolidin-2-one |
| SMILES | CCCC[C@@H](O)[C@H]1[C@@H](OCc2ccccc2)CC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H29NO3/c1-2-3-14-20(25)23-21(27-17-19-12-8-5-9-13-19)15-22(26)24(23)16-18-10-6-4-7-11-18/h4-13,20-21,23,25H,2-3,14-17H2,1H3/t20-,21+,23+/m1/s1 |
| InChIKey | XBBRLJDMFPZRMB-GIWBLDEGSA-N |
| XLogP | 3.92 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |