C10H13NO2S2 — CID 11687384
3-pyridin-2-ylsulfanylthiane 1,1-dioxide (PubChem CID 11687384) has the molecular formula C10H13NO2S2 and a molecular weight of 243.35 g/mol. Its IUPAC name is 3-pyridin-2-ylsulfanylthiane 1,1-dioxide.
| Compound Name | 3-pyridin-2-ylsulfanylthiane 1,1-dioxide |
|---|---|
| PubChem CID | 11687384 |
| Molecular Formula | C10H13NO2S2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 3-pyridin-2-ylsulfanylthiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCC(Sc2ccccn2)C1 |
| InChI | InChI=1S/C10H13NO2S2/c12-15(13)7-3-4-9(8-15)14-10-5-1-2-6-11-10/h1-2,5-6,9H,3-4,7-8H2 |
| InChIKey | QRVVVGJOUJNJMG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |