C16H16N2O3S2 — CID 94796018
N-[(3S)-1,1-dioxothiolan-3-yl]-4-pyridin-2-ylsulfanylbenzamide (PubChem CID 94796018) has the molecular formula C16H16N2O3S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-4-pyridin-2-ylsulfanylbenzamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-4-pyridin-2-ylsulfanylbenzamide |
|---|---|
| PubChem CID | 94796018 |
| Molecular Formula | C16H16N2O3S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-4-pyridin-2-ylsulfanylbenzamide |
| SMILES | O=C(N[C@H]1CCS(=O)(=O)C1)c1ccc(Sc2ccccn2)cc1 |
| InChI | InChI=1S/C16H16N2O3S2/c19-16(18-13-8-10-23(20,21)11-13)12-4-6-14(7-5-12)22-15-3-1-2-9-17-15/h1-7,9,13H,8,10-11H2,(H,18,19)/t13-/m0/s1 |
| InChIKey | FMSZVWNAVKLHKQ-ZDUSSCGKSA-N |
| XLogP | 2.15 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |