C15H10F2N2O2S — CID 17035942
1-(3,4-difluorophenyl)-3-pyridin-2-ylsulfanylpyrrolidine-2,5-dione (PubChem CID 17035942) has the molecular formula C15H10F2N2O2S and a molecular weight of 320.32 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-pyridin-2-ylsulfanylpyrrolidine-2,5-dione.
| Compound Name | 1-(3,4-difluorophenyl)-3-pyridin-2-ylsulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 17035942 |
| Molecular Formula | C15H10F2N2O2S |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-pyridin-2-ylsulfanylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(Sc2ccccn2)C(=O)N1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H10F2N2O2S/c16-10-5-4-9(7-11(10)17)19-14(20)8-12(15(19)21)22-13-3-1-2-6-18-13/h1-7,12H,8H2 |
| InChIKey | RARBRHFCEJBPIM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|