C16H13F2N3O2S — CID 29158192
(3S)-1-(3,4-difluorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrolidine-2,5-dione (PubChem CID 29158192) has the molecular formula C16H13F2N3O2S and a molecular weight of 349.36 g/mol. Its IUPAC name is (3S)-1-(3,4-difluorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(3,4-difluorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 29158192 |
| Molecular Formula | C16H13F2N3O2S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | (3S)-1-(3,4-difluorophenyl)-3-(4,6-dimethylpyrimidin-2-yl)sulfanylpyrrolidine-2,5-dione |
| SMILES | Cc1cc(C)nc(S[C@H]2CC(=O)N(c3ccc(F)c(F)c3)C2=O)n1 |
| InChI | InChI=1S/C16H13F2N3O2S/c1-8-5-9(2)20-16(19-8)24-13-7-14(22)21(15(13)23)10-3-4-11(17)12(18)6-10/h3-6,13H,7H2,1-2H3/t13-/m0/s1 |
| InChIKey | VFDYTNCQQOZGLK-ZDUSSCGKSA-N |
| XLogP | 2.80 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|