C15H11Cl2N3O2S — CID 1072389
(3S)-1-(3,4-dichlorophenyl)-3-(4-methylpyrimidin-2-yl)sulfanylpyrrolidine-2,5-dione (PubChem CID 1072389) has the molecular formula C15H11Cl2N3O2S and a molecular weight of 368.25 g/mol. Its IUPAC name is (3S)-1-(3,4-dichlorophenyl)-3-(4-methylpyrimidin-2-yl)sulfanylpyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(3,4-dichlorophenyl)-3-(4-methylpyrimidin-2-yl)sulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1072389 |
| Molecular Formula | C15H11Cl2N3O2S |
| Molecular Weight | 368.25 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | (3S)-1-(3,4-dichlorophenyl)-3-(4-methylpyrimidin-2-yl)sulfanylpyrrolidine-2,5-dione |
| SMILES | Cc1ccnc(S[C@H]2CC(=O)N(c3ccc(Cl)c(Cl)c3)C2=O)n1 |
| InChI | InChI=1S/C15H11Cl2N3O2S/c1-8-4-5-18-15(19-8)23-12-7-13(21)20(14(12)22)9-2-3-10(16)11(17)6-9/h2-6,12H,7H2,1H3/t12-/m0/s1 |
| InChIKey | XWKJMAXEQWNJCH-LBPRGKRZSA-N |
| XLogP | 3.52 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.25 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|