C20H17ClN4O2S — CID 1319629
(3S)-1-(3-chloro-4-methylphenyl)-3-[[5-(3-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]pyrrolidine-2,5-dione (PubChem CID 1319629) has the molecular formula C20H17ClN4O2S and a molecular weight of 412.90 g/mol. Its IUPAC name is (3S)-1-(3-chloro-4-methylphenyl)-3-[[5-(3-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(3-chloro-4-methylphenyl)-3-[[5-(3-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1319629 |
| Molecular Formula | C20H17ClN4O2S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | (3S)-1-(3-chloro-4-methylphenyl)-3-[[5-(3-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]pyrrolidine-2,5-dione |
| SMILES | Cc1cccc(-c2nc(S[C@H]3CC(=O)N(c4ccc(C)c(Cl)c4)C3=O)n[nH]2)c1 |
| InChI | InChI=1S/C20H17ClN4O2S/c1-11-4-3-5-13(8-11)18-22-20(24-23-18)28-16-10-17(26)25(19(16)27)14-7-6-12(2)15(21)9-14/h3-9,16H,10H2,1-2H3,(H,22,23,24)/t16-/m0/s1 |
| InChIKey | OITNYEDBGATJQF-INIZCTEOSA-N |
| XLogP | 4.17 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|