C20H18N4O4S — CID 1395428
(3S)-1-(2,5-dimethoxyphenyl)-3-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrrolidine-2,5-dione (PubChem CID 1395428) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is (3S)-1-(2,5-dimethoxyphenyl)-3-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(2,5-dimethoxyphenyl)-3-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1395428 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | (3S)-1-(2,5-dimethoxyphenyl)-3-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(OC)c(N2C(=O)C[C@H](Sc3n[nH]c(-c4ccccc4)n3)C2=O)c1 |
| InChI | InChI=1S/C20H18N4O4S/c1-27-13-8-9-15(28-2)14(10-13)24-17(25)11-16(19(24)26)29-20-21-18(22-23-20)12-6-4-3-5-7-12/h3-10,16H,11H2,1-2H3,(H,21,22,23)/t16-/m0/s1 |
| InChIKey | QHZGPRYAVRTPSO-INIZCTEOSA-N |
| XLogP | 2.91 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|