C22H21N3O4S — CID 2932531
1-(2-ethoxyphenyl)-3-(6-methoxy-4-methylquinazolin-2-yl)sulfanylpyrrolidine-2,5-dione (PubChem CID 2932531) has the molecular formula C22H21N3O4S and a molecular weight of 423.49 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-3-(6-methoxy-4-methylquinazolin-2-yl)sulfanylpyrrolidine-2,5-dione.
| Compound Name | 1-(2-ethoxyphenyl)-3-(6-methoxy-4-methylquinazolin-2-yl)sulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2932531 |
| Molecular Formula | C22H21N3O4S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 1-(2-ethoxyphenyl)-3-(6-methoxy-4-methylquinazolin-2-yl)sulfanylpyrrolidine-2,5-dione |
| SMILES | CCOc1ccccc1N1C(=O)CC(Sc2nc(C)c3cc(OC)ccc3n2)C1=O |
| InChI | InChI=1S/C22H21N3O4S/c1-4-29-18-8-6-5-7-17(18)25-20(26)12-19(21(25)27)30-22-23-13(2)15-11-14(28-3)9-10-16(15)24-22/h5-11,19H,4,12H2,1-3H3 |
| InChIKey | KDMKIXCQDDHJOM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|