C13H11BrN4O2S — CID 94188863
(3R)-1-(4-bromophenyl)-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrrolidine-2,5-dione (PubChem CID 94188863) has the molecular formula C13H11BrN4O2S and a molecular weight of 367.23 g/mol. Its IUPAC name is (3R)-1-(4-bromophenyl)-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(4-bromophenyl)-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 94188863 |
| Molecular Formula | C13H11BrN4O2S |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | (3R)-1-(4-bromophenyl)-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pyrrolidine-2,5-dione |
| SMILES | Cc1nc(S[C@@H]2CC(=O)N(c3ccc(Br)cc3)C2=O)n[nH]1 |
| InChI | InChI=1S/C13H11BrN4O2S/c1-7-15-13(17-16-7)21-10-6-11(19)18(12(10)20)9-4-2-8(14)3-5-9/h2-5,10H,6H2,1H3,(H,15,16,17)/t10-/m1/s1 |
| InChIKey | SPZPMRVGEFNFOC-SNVBAGLBSA-N |
| XLogP | 2.30 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|