C13H10F2N4O2S — CID 17035940
1-(3,4-difluorophenyl)-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyrrolidine-2,5-dione (PubChem CID 17035940) has the molecular formula C13H10F2N4O2S and a molecular weight of 324.31 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyrrolidine-2,5-dione.
| Compound Name | 1-(3,4-difluorophenyl)-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 17035940 |
| Molecular Formula | C13H10F2N4O2S |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]pyrrolidine-2,5-dione |
| SMILES | Cn1cnnc1SC1CC(=O)N(c2ccc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C13H10F2N4O2S/c1-18-6-16-17-13(18)22-10-5-11(20)19(12(10)21)7-2-3-8(14)9(15)4-7/h2-4,6,10H,5H2,1H3 |
| InChIKey | RDXKKYVGALXEIA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|