C17H20F2N2O2 — CID 29101458
(3R)-1-(3,4-difluorophenyl)-3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrrolidine-2,5-dione (PubChem CID 29101458) has the molecular formula C17H20F2N2O2 and a molecular weight of 322.36 g/mol. Its IUPAC name is (3R)-1-(3,4-difluorophenyl)-3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(3,4-difluorophenyl)-3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 29101458 |
| Molecular Formula | C17H20F2N2O2 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (3R)-1-(3,4-difluorophenyl)-3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrrolidine-2,5-dione |
| SMILES | C[C@@H]1C[C@@H](C)CN([C@@H]2CC(=O)N(c3ccc(F)c(F)c3)C2=O)C1 |
| InChI | InChI=1S/C17H20F2N2O2/c1-10-5-11(2)9-20(8-10)15-7-16(22)21(17(15)23)12-3-4-13(18)14(19)6-12/h3-4,6,10-11,15H,5,7-9H2,1-2H3/t10-,11-,15-/m1/s1 |
| InChIKey | KCXFBPJKYGOGIF-UEKVPHQBSA-N |
| XLogP | 2.57 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|