C16H19BrN2O3 — CID 7784115
(3R)-1-(4-bromophenyl)-3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrrolidine-2,5-dione (PubChem CID 7784115) has the molecular formula C16H19BrN2O3 and a molecular weight of 367.24 g/mol. Its IUPAC name is (3R)-1-(4-bromophenyl)-3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(4-bromophenyl)-3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7784115 |
| Molecular Formula | C16H19BrN2O3 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | (3R)-1-(4-bromophenyl)-3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrrolidine-2,5-dione |
| SMILES | C[C@@H]1CN([C@@H]2CC(=O)N(c3ccc(Br)cc3)C2=O)C[C@H](C)O1 |
| InChI | InChI=1S/C16H19BrN2O3/c1-10-8-18(9-11(2)22-10)14-7-15(20)19(16(14)21)13-5-3-12(17)4-6-13/h3-6,10-11,14H,7-9H2,1-2H3/t10-,11+,14-/m1/s1 |
| InChIKey | HJFDSTNLZRCRPS-UHIISALHSA-N |
| XLogP | 2.19 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|