C16H18Br2N2O3 — CID 1202052
(3R)-1-(2,4-dibromophenyl)-3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrrolidine-2,5-dione (PubChem CID 1202052) has the molecular formula C16H18Br2N2O3 and a molecular weight of 446.14 g/mol. Its IUPAC name is (3R)-1-(2,4-dibromophenyl)-3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(2,4-dibromophenyl)-3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1202052 |
| Molecular Formula | C16H18Br2N2O3 |
| Molecular Weight | 446.14 g/mol |
| Exact Mass | 443.97 |
| IUPAC Name | (3R)-1-(2,4-dibromophenyl)-3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrrolidine-2,5-dione |
| SMILES | C[C@@H]1CN([C@@H]2CC(=O)N(c3ccc(Br)cc3Br)C2=O)C[C@H](C)O1 |
| InChI | InChI=1S/C16H18Br2N2O3/c1-9-7-19(8-10(2)23-9)14-6-15(21)20(16(14)22)13-4-3-11(17)5-12(13)18/h3-5,9-10,14H,6-8H2,1-2H3/t9-,10+,14-/m1/s1 |
| InChIKey | XUFWPLOWDHKXCA-ISTVAULSSA-N |
| XLogP | 2.95 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.14 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|