C18H16ClNO4S — CID 1344999
(3R)-3-(4-chlorophenyl)sulfanyl-1-(3,5-dimethoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 1344999) has the molecular formula C18H16ClNO4S and a molecular weight of 377.85 g/mol. Its IUPAC name is (3R)-3-(4-chlorophenyl)sulfanyl-1-(3,5-dimethoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(4-chlorophenyl)sulfanyl-1-(3,5-dimethoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1344999 |
| Molecular Formula | C18H16ClNO4S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | (3R)-3-(4-chlorophenyl)sulfanyl-1-(3,5-dimethoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1cc(OC)cc(N2C(=O)C[C@@H](Sc3ccc(Cl)cc3)C2=O)c1 |
| InChI | InChI=1S/C18H16ClNO4S/c1-23-13-7-12(8-14(9-13)24-2)20-17(21)10-16(18(20)22)25-15-5-3-11(19)4-6-15/h3-9,16H,10H2,1-2H3/t16-/m1/s1 |
| InChIKey | HOQZPCVPAUTXTM-MRXNPFEDSA-N |
| XLogP | 3.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|